CAS 31301-28-7
:4-Methyl-1,10-phenanthroline
Description:
4-Methyl-1,10-phenanthroline is an organic compound characterized by its structure, which consists of a phenanthroline core with a methyl group attached to the fourth position of the first ring. This compound is known for its chelating properties, allowing it to form stable complexes with various metal ions, making it useful in coordination chemistry and analytical applications. It typically appears as a crystalline solid and is soluble in organic solvents. The presence of nitrogen atoms in its structure contributes to its ability to coordinate with metals, which is significant in fields such as catalysis and materials science. Additionally, 4-Methyl-1,10-phenanthroline exhibits fluorescence, which can be exploited in sensing applications. Its chemical stability and reactivity can vary depending on the surrounding environment, including pH and the presence of other ligands. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H10N2
InChI:InChI=1S/C13H10N2/c1-9-6-8-15-13-11(9)5-4-10-3-2-7-14-12(10)13/h2-8H,1H3
InChI key:InChIKey=NAZZKEZTSOOCSZ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C3C(=CC2)C=CC=N3)N=CC1
Synonyms:- 1,10-Phenanthroline, 4-methyl-
- 4-Methyl-1,10-phenanthroline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Methyl-1,10-phenanthroline
CAS:4-methyl-1,10-phenanthroline can be used to produce 1,10-Phenanthrolin-4-aldehyde. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item coFormula:C13H10N2Molecular weight:194.244-Methyl-1,10-phenanthroline
CAS:Formula:C13H10N2Purity:95%Color and Shape:SolidMolecular weight:194.23194-Methyl-1,10-phenanthroline
CAS:4-Methyl-1,10-phenanthroline (4MP) is a functional molecule that has been extensively studied for its use as an anticancer agent. 4MP is a racemic mixture of 4-methyl and 1,10-phenanthroline enantiomers. It has shown anticancer activity in the L1210 murine leukemia model and cisplatin-resistant human ovarian cancer cells. The binding constants of 4MP to DNA depend on the orientation of the molecule with respect to the DNA helix. The cis configuration binds more tightly than the trans configuration, which may be due to steric hindrance. 4MP inhibits luminescence by interacting with micelles and forming aggregates in water.
Formula:C13H10N2Purity:Min. 95%Molecular weight:194.23 g/mol





