CymitQuimica logo

CAS 31324-77-3

:

Dichloromethylphenylsilane homopolymer

Description:
Dichloromethylphenylsilane homopolymer, identified by its CAS number 31324-77-3, is a silicone-based polymer characterized by its unique chemical structure, which includes dichloromethyl and phenyl functional groups. This polymer exhibits notable thermal stability and chemical resistance, making it suitable for various applications in industries such as coatings, adhesives, and sealants. The presence of chloromethyl groups allows for further functionalization, enhancing its versatility in chemical reactions. Additionally, the phenyl groups contribute to its mechanical strength and optical properties. The polymer typically demonstrates good adhesion to various substrates and can be processed into different forms, including films and coatings. Its hydrophobic nature and resistance to moisture make it particularly valuable in environments where durability and longevity are essential. Overall, dichloromethylphenylsilane homopolymer is a significant material in advanced polymer chemistry, offering a balance of performance characteristics that cater to specialized industrial needs.
Formula:(C7H8Cl2Si)x
InChI:InChI=1S/C7H8Cl2Si/c1-10(8,9)7-5-3-2-4-6-7/h2-6H,1H3
InChI key:InChIKey=GNEPOXWQWFSSOU-UHFFFAOYSA-N
SMILES:[Si](C)(Cl)(Cl)C1=CC=CC=C1
Synonyms:
  • Dichloromethylphenylsilane homopolymer
  • Silane, dichloromethylphenyl-, homopolymer
  • Benzene, (dichloromethylsilyl)-, homopolymer
  • Poly(phenylmethyldichlorosilane)
  • Silane, dichloromethylphenyl-, polymers
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.