CAS 31329-64-3

3,5-Dimethyl-4-isoxazolamine

Description:

3,5-Dimethyl-4-isoxazolamine is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features two methyl groups attached to the 3 and 5 positions of the isoxazole ring, contributing to its unique chemical properties. The presence of the amino group at the 4-position enhances its reactivity and solubility in polar solvents. Typically, compounds like 3,5-Dimethyl-4-isoxazolamine exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with various biological targets, which can lead to therapeutic applications. Additionally, its stability and reactivity can be influenced by the substituents on the isoxazole ring, making it a versatile compound for further chemical modifications. Overall, 3,5-Dimethyl-4-isoxazolamine represents a class of compounds that are valuable in both research and pharmaceutical contexts due to their distinctive structural features and potential biological activities.

Formula: C₅H₈N₂O

InChI: InChI=1/C5H8N2O/c1-3-5(6)4(2)8-7-3/h6H2,1-2H3

SMILES: Cc1c(c(C)on1)N

Synonyms:

• Timtec-Bb Sbb005896
• Akos B020738
• 3,5-Dimethyl-Isoxazol-4-Ylamine
• 4-Amino-3,5-Dimethylisoxazole
• Art-Chem-Bb B020738
• 3,5-Dimethylisoxazol-4-Amine
• 3,5-Dimethylisoxazole-4-amine
• 3,5-Dimethyl-1,2-Oxazol-4-Amine

3,5-Dimethylisoxazol-4-amine

CAS: 31329-64-3

Formula: C₅H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 112.1298

Ref: IN-DA003IOY

4-Amino-3,5-dimethylisoxazole

CAS: 31329-64-3

4-Amino-3,5-dimethylisoxazole

Purity: 97%

Color and Shape: Solid

Molecular weight: 112.13g/mol

Ref: 54-OR22972

3,5-Dimethyl-isoxazol-4-ylamine

CAS: 31329-64-3

Formula: C₅H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 112.132

Ref: 10-F030137