CAS 3133-78-6
:3-Methylbenzo[b]thiophene-2-carboxylic acid
Description:
3-Methylbenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring fused with a carboxylic acid functional group. This compound features a methyl group at the 3-position of the thiophene ring, contributing to its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the carboxylic acid group allows for potential hydrogen bonding and reactivity in various chemical reactions, such as esterification or amidation. Additionally, this compound may possess interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its molecular structure can influence its physical properties, such as melting point and boiling point, as well as its behavior in chemical reactions. Overall, 3-Methylbenzo[b]thiophene-2-carboxylic acid is a versatile compound with applications in various fields of chemistry.
Formula:C10H7O2S
InChI:InChI=1/C10H8O2S/c1-6-7-4-2-3-5-8(7)13-9(6)10(11)12/h2-5H,1H3,(H,11,12)/p-1
SMILES:Cc1c2ccccc2sc1C(=O)[O-]
Synonyms:- 3-Methyl-1-benzothiophene-2-carboxylic acid
- Benzo[b]thiophene-2-carboxylic acid, 3-methyl-
- 3-Methyl-1-Benzothiophene-2-Carboxylate
- 3-Methylbenzothiophene-2-carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methylbenzo[b]thiophene-2-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H8O2SPurity:97%Molecular weight:192.243-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H8O2SPurity:97%Color and Shape:SolidMolecular weight:192.23433-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:3-Methylbenzo[b]thiophene-2-carboxylic acidPurity:97%Molecular weight:192.24g/mol3-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H8O2SPurity:95%Color and Shape:Liquid, No data available.Molecular weight:192.233-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:3-Methylbenzo[b]thiophene-2-carboxylic acid (MBTCA) is a heterocyclic compound that is an intermediate in the synthesis of 3-methylthiophene-2-carboxylic acid, a precursor to other drugs. MBTCA is an aerobic, nonpolar compound that has shown antimicrobial activity against some bacteria and fungi. It also has been shown to have practicality as a biomolecular probe for methyl groups in organic solvents. MBTCA can be synthesized by nitration of benzene in the presence of sulfur and sulfoxides. This reaction produces nitrobenzene, which can then be oxidized by potassium permanganate or hydrogen peroxide to produce MBTCA. The most common isomer of MBTCA is 2-(3,5-dimethoxybenzylidene)tetrahydrofuran, with three methyl groups on the
Formula:C10H8O2SPurity:Min. 95%Molecular weight:192.23 g/mol




