CymitQuimica logo

CAS 313337-32-5

:

1H-Indole,4-fluoro-7-methyl-

Description:
1H-Indole, 4-fluoro-7-methyl- is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and a methyl group at the 7-position distinguishes it from other indole derivatives. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in organic solvents. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs. The fluorine substitution can influence the compound's electronic properties and reactivity, potentially enhancing its pharmacological profile. Additionally, the indole framework is known for its role in various natural products and its significance in medicinal chemistry, often serving as a scaffold for the synthesis of diverse bioactive molecules. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H8FN
InChI:InChI=1S/C9H8FN/c1-6-2-3-8(10)7-4-5-11-9(6)7/h2-5,11H,1H3
InChI key:HQIRUGMHWJZMJJ-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C=C1)F)C=CN2
Synonyms:
  • 1H-Indole,4-fluoro-7-methyl-(9CI)
  • 1H-Indole, 4-fluoro-7-Methyl-
Found 2 products.