CAS 313337-34-7

4-fluoro-1H-indole-7-carboxylic acid

Description:

4-Fluoro-1H-indole-7-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxylic acid group (-COOH) at the 7-position and a fluorine atom at the 4-position of the indole ring contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It may exhibit acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. 4-Fluoro-1H-indole-7-carboxylic acid is of interest in medicinal chemistry and research, particularly in the development of pharmaceuticals, due to its potential as a building block for more complex molecules. Its specific applications and biological activities would depend on further studies and investigations.

Formula: C₉H₆FNO₂

InChI: InChI=1/C9H6FNO2/c10-7-2-1-6(9(12)13)8-5(7)3-4-11-8/h1-4,11H,(H,12,13)

SMILES: c1cc(c2cc[nH]c2c1C(=O)O)F

Synonyms:

• 4-FLUORO-7-INDOLE CARBOXYLIC ACID
• 1H-Indole-7-carboxylic acid, 4-fluoro-
• 4-Fluoro indole-7-carboxylic aicd
• 4-fluoro-1H-indole-7-carboxylic acid
• 7-Carboxy-4-fluoro-1H-indole

4-Fluoro-1H-indole-7-carboxylic acid

CAS: 313337-34-7

Formula: C₉H₆FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.1478

Ref: IN-DA00CW3O

4-Fluoro-1H-indole-7-carboxylic acid

CAS: 313337-34-7

4-Fluoro-1H-indole-7-carboxylic acid

Purity: 97%

Molecular weight: 179.15g/mol

Ref: 54-PC6002

4-Fluoro-1H-indole-7-carboxylic acid

CAS: 313337-34-7

Formula: C₉H₆FNO₂

Purity: 98%

Color and Shape: No data available.

Molecular weight: 179.15

Ref: 10-F235400