CAS 313348-29-7
:1-(6-Amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid
Description:
1-(6-Amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid, identified by its CAS number 313348-29-7, is a chemical compound that features a complex structure combining elements of purine and pyrazole chemistry. This substance is characterized by the presence of a ribofuranosyl moiety, which is indicative of its potential biological activity, particularly in nucleoside analogs. The amino group at the 6-position of the purine ring suggests that it may participate in various biochemical interactions, possibly influencing nucleic acid metabolism or signaling pathways. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, which is essential for its reactivity and potential therapeutic applications. Overall, this compound may exhibit properties relevant to medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to its structural similarity to naturally occurring nucleosides. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C14H15N7O6
InChI:InChI=1S/C14H15N7O6/c15-10-7-11(19-14(18-10)21-2-5(1-17-21)13(25)26)20(4-16-7)12-9(24)8(23)6(3-22)27-12/h1-2,4,6,8-9,12,22-24H,3H2,(H,25,26)(H2,15,18,19)/t6-,8-,9-,12-/m1/s1
InChI key:InChIKey=NLDXPPQYALPBFB-WOUKDFQISA-N
SMILES:NC1=C2C(N(C=N2)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)=NC(=N1)N4C=C(C(O)=O)C=N4
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 1-(6-amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-
- 1-(6-Amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Regadenoson Acid (1-(6-Amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C14H15N7O6Color and Shape:Light Yellow PowderMolecular weight:377.108381-(6-Amino-9-b-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid
CAS:Controlled ProductApplications 1-(6-Amino-9-β-D-ribofuranosyl-9H-purin-2-yl)-1H-pyrazole-4-carboxylic acid is used in the preparation of adenosine receptor nanoagonists.
References Gao, X., et al.: ACS Nano, 8, 3678 (2014)Formula:C14H15N7O6Color and Shape:NeatMolecular weight:377.31



