CAS 31354-48-0

N-(3-hydroxypyridin-2-yl)acetamide

Description:

N-(3-hydroxypyridin-2-yl)acetamide, with the CAS number 31354-48-0, is an organic compound characterized by its pyridine ring structure, which is substituted with a hydroxyl group at the 3-position and an acetamide group. This compound typically exhibits properties associated with both amides and hydroxypyridines, including potential solubility in polar solvents due to the presence of the hydroxyl group. It may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The presence of the hydroxypyridine moiety suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features may allow it to act as a ligand in coordination chemistry or as a precursor in the synthesis of more complex organic compounds. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-5(10)9-7-6(11)3-2-4-8-7/h2-4,11H,1H3,(H,8,9,10)

SMILES: CC(=Nc1c(cccn1)O)O

Synonyms:

• 2-(Acetylamino)-3-pyridinol
• acetamide, N-(3-hydroxy-2-pyridinyl)-

2-Acetamido-3-hydroxypyridine

CAS: 31354-48-0

Formula: C₇H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA00CK13

2-Acetamido-3-hydroxypyridine

CAS: 31354-48-0

2-Acetamido-3-hydroxypyridine

Purity: 98%

Molecular weight: 152.15g/mol

Ref: 54-OR959383

N-(3-hydroxy-2-pyridinyl)acetamide

CAS: 31354-48-0

Formula: C₇H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.153

Ref: 10-F311500