CAS 313545-33-4

B-[2-Chloro-4-(difluoromethoxy)phenyl]boronic acid

Description:

B-[2-Chloro-4-(difluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring and a difluoromethoxy substituent, which can influence its reactivity and solubility. The presence of the boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the difluoromethoxy group may enhance the compound's lipophilicity and biological activity. This compound is typically handled with care due to the potential reactivity of boronic acids and the presence of halogenated groups, which may pose environmental and health risks. Overall, B-[2-Chloro-4-(difluoromethoxy)phenyl]boronic acid is a valuable building block in the development of pharmaceuticals and agrochemicals.

Formula: C₇H₆BClF₂O₃

InChI: InChI=1S/C7H6BClF2O3/c9-6-3-4(14-7(10)11)1-2-5(6)8(12)13/h1-3,7,12-13H

InChI key: InChIKey=VGTCSOILLLIGBD-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Cl)C=C(OC(F)F)C=C1

Synonyms:

• Boronic acid, B-[2-chloro-4-(difluoromethoxy)phenyl]-
• (2-Chloro-4-difluoromethoxyphenyl)boronic acid
• B-[2-Chloro-4-(difluoromethoxy)phenyl]boronic acid
• 2-Chloro-4-(difluoromethoxy)benzeneboronic acid
• Boronic acid, [2-chloro-4-(difluoromethoxy)phenyl]-

(2-Chloro-4-(difluoromethoxy)phenyl)boronic acid

CAS: 313545-33-4

Formula: C₇H₆BClF₂O₃

Purity: 95%

Molecular weight: 222.3815

Ref: IN-DA01DK9F

(2-Chloro-4-(difluoromethoxy)phenyl)boronic acid

CAS: 313545-33-4

Purity: 95%

Molecular weight: 222.3800049

Ref: 10-F627238