CAS 313545-72-1
:2-Chloro-4-fluorobenzeneboronic acid
Description:
2-Chloro-4-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and halogen substituents on a benzene ring. Its molecular structure features a benzene ring with a chlorine atom at the 2-position and a fluorine atom at the 4-position, along with a boronic acid group (-B(OH)2) that enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols due to the presence of the boronic acid group. It is used in organic synthesis, particularly in the formation of carbon-carbon bonds, and has applications in medicinal chemistry and materials science. The presence of both chlorine and fluorine atoms can influence its electronic properties and reactivity, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential toxicity and reactivity.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,10-11H
SMILES:c1cc(c(cc1F)Cl)B(O)O
Synonyms:- (2-Chloro-4-fluorophenyl)boronic acid
- boronic acid, B-(2-chloro-4-fluorophenyl)-
- 2-Chloro-4-Fluorophenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloro-4-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BClFO2Purity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:174.362-Chloro-4-fluorobenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5BClFO2Purity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:174.362-Chloro-4-fluorophenylboronic acid
CAS:Formula:C6H5BClFO2Purity:98%Color and Shape:SolidMolecular weight:174.36512-Chloro-4-fluorobenzeneboronic acid
CAS:2-Chloro-4-fluorobenzeneboronic acidFormula:C6H5BClFO2Purity:98%Color and Shape: white crystalline solidMolecular weight:174.3651g/mol2-Chloro-4-fluorophenylboronic acid
CAS:Formula:C6H5BClFO2Purity:96%Color and Shape:SolidMolecular weight:174.36







