CymitQuimica logo

CAS 313546-18-8

:

B-(4-Cyano-2-methylphenyl)boronic acid

Description:
B-(4-Cyano-2-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyano and a methyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having a relatively low melting point. The cyano group contributes to its electronic properties, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. The boronic acid functionality allows for the formation of stable complexes with diols, which can be exploited in sensing applications and in the development of pharmaceuticals. Additionally, the presence of the methyl group can influence the steric and electronic properties of the molecule, affecting its reactivity and interactions with other chemical species. Overall, B-(4-Cyano-2-methylphenyl)boronic acid is a versatile compound with significant applications in organic chemistry and materials science.
Formula:C8H8BNO2
InChI:InChI=1S/C8H8BNO2/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,11-12H,1H3
InChI key:InChIKey=RGCVYEOTYJCNOS-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C)C=C(C#N)C=C1
Synonyms:
  • 2-Methyl-4-cyanophenylboronic acid
  • (4-Cyano-2-methylphenyl)boronic acid
  • Boronic acid, B-(4-cyano-2-methylphenyl)-
  • Boronic acid, (4-cyano-2-methylphenyl)-
  • B-(4-Cyano-2-methylphenyl)boronic acid
Found 4 products.