CAS 313546-19-9

B-(3-Cyano-2-methylphenyl)boronic acid

Description:

B-(3-Cyano-2-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a cyano and a methyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The cyano group contributes to the compound's electronic properties, potentially enhancing its reactivity and interactions with biological targets. Additionally, the presence of the methyl group can influence the steric and electronic environment around the boron atom, affecting its reactivity and the overall behavior of the compound in chemical reactions. Overall, B-(3-Cyano-2-methylphenyl)boronic acid is a versatile building block in the synthesis of complex organic molecules.

Formula: C₈H₈BNO₂

InChI: InChI=1S/C8H8BNO2/c1-6-7(5-10)3-2-4-8(6)9(11)12/h2-4,11-12H,1H3

InChI key: InChIKey=FBHYTUYMTRDCOI-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C)C(C#N)=CC=C1

Synonyms:

• B-(3-Cyano-2-methylphenyl)boronic acid
• Boronic acid, B-(3-cyano-2-methylphenyl)-
• 2-Methyl-3-cyanophenylboronic acid
• (3-Cyano-2-methylphenyl)boronic acid
• Boronic acid, (3-cyano-2-methylphenyl)-

3-Cyano-2-methylphenylboronic acid

CAS: 313546-19-9

Formula: C₈H₈BNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 160.9656

Ref: IN-DA007H9O

3-Cyano-2-methylphenylboronic acid

CAS: 313546-19-9

3-Cyano-2-methylphenylboronic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.97g/mol

Ref: 54-OR361032

3-Cyano-2-methylphenylboronic acid

CAS: 313546-19-9

Formula: C₈H₈BNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 160.97

Ref: 10-F519597

3-Cyano-2-methylphenylboronic acid

CAS: 313546-19-9

3-Cyano-2-methylphenylboronic acid is a high quality compound that can be used as a reagent, intermediate, or building block in the synthesis of complex compounds. This chemical is also useful as a speciality chemical and research chemical. 3-Cyano-2-methylphenylboronic acid has versatile uses in organic synthesis due to its versatility in reactions and building blocks.

Formula: C₈H₈BNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 160.97 g/mol

Ref: 3D-FC76289