CAS 313657-25-9

N-1-Benzyl-3-ethylpiperazine

Description:

N-1-Benzyl-3-ethylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to one nitrogen atom and an ethyl group attached to the third position of the piperazine ring. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate hydrophobicity due to the presence of the benzyl group. The compound may exhibit basic properties due to the nitrogen atoms in the piperazine ring, allowing it to form salts with acids. N-1-Benzyl-3-ethylpiperazine is of interest in medicinal chemistry and pharmacology, as piperazine derivatives often display a range of biological activities, including potential use as anxiolytics or antidepressants. However, specific biological activity and safety profiles would require further investigation through empirical studies. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₂₀N₂

InChI: InChI=1/C13H20N2/c1-2-13-11-15(9-8-14-13)10-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3

SMILES: CCC1CN(CCN1)Cc1ccccc1

Synonyms:

• 1-Benzyl-3-ethylpiperazine
• Piperazine, 3-Ethyl-1-(Phenylmethyl)-

1-Benzyl-3-ethylpiperazine

CAS: 313657-25-9

1-Benzyl-3-ethylpiperazine

Formula: C₁₃H₂₀N₂

Purity: 95%

Color and Shape: hazy. dark yellow to light brown liquid

Molecular weight: 204.31g/mol

Ref: 54-OR16017