CAS 3137-60-8
:5-amino-6-chloropyrimidin-4(1H)-one
Description:
5-Amino-6-chloropyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both amino and chloro substituents. The presence of the amino group (-NH2) at the 5-position and the chloro group (-Cl) at the 6-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its structure allows for potential interactions with biological targets, making it of interest in drug development and synthesis of pharmaceuticals. The compound's CAS number, 3137-60-8, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 5-amino-6-chloropyrimidin-4(1H)-one serves as a valuable building block in organic synthesis and has implications in the development of therapeutic agents.
Formula:C4H4ClN3O
InChI:InChI=1/C4H4ClN3O/c5-3-2(6)4(9)8-1-7-3/h1H,6H2,(H,7,8,9)
SMILES:c1nc(c(c(n1)O)N)Cl
Synonyms:- 4-Pyrimidinol, 5-amino-6-chloro-
- 5-Amino-6-chloropyrimidin-4-ol
- 5-Amino-6-Chloro-Pyrimidin-4-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4(1H)-Pyrimidinone, 5-amino-6-chloro- (9CI)
CAS:Formula:C4H4ClN3OPurity:95%Color and Shape:SolidMolecular weight:145.54715-Amino-6-chloro-1H-pyrimidin-4-one
CAS:5-Amino-6-chloro-1H-pyrimidin-4-onePurity:95%Molecular weight:145.55g/mol5-Amino-6-chloro-pyrimidin-4-ol
CAS:<p>5-Amino-6-chloro-pyrimidin-4-ol is a triethyl orthoformate. It is prepared by the reaction of anhydrous ammonia with formaldehyde and hydrochloric acid, followed by the addition of ethyl bromide. The product can be converted to 5,6-dichloropyrimidine using base or hydrochloric acid. This compound reacts with water to produce hydrogen chloride gas and 5,6-dichloropyrimidine. 5,6-Dichloropyrimidine can be used as a precursor for other compounds such as 2,5,6-triamino pyrimidinol (2) and 2,5,6-trichloropyridazine (3).</p>Formula:C4H4ClN3OPurity:Min. 95%Molecular weight:145.55 g/mol


