CAS 31386-25-1
:Indocate
Description:
Indocate, with the CAS number 31386-25-1, is a chemical compound that belongs to the class of indole derivatives. It is characterized by its unique structure, which includes an indole ring, a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. Indocate is often recognized for its potential applications in various fields, including pharmaceuticals and dyes, due to its ability to interact with biological systems and its vibrant color properties. The compound may exhibit specific solubility characteristics, typically being soluble in organic solvents while having limited solubility in water. Its reactivity can be influenced by the presence of functional groups attached to the indole structure, which can participate in various chemical reactions, such as electrophilic substitutions. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C22H26N2O2
InChI:InChI=1/C22H26N2O2/c1-16-17(2)24(15-18-8-6-5-7-9-18)21-11-10-19(14-20(16)21)22(25)26-13-12-23(3)4/h5-11,14H,12-13,15H2,1-4H3
SMILES:Cc1c(C)n(Cc2ccccc2)c2ccc(cc12)C(=O)OCCN(C)C
Synonyms:- Indocate [INN]
- Indocato
- Indocato [INN-Spanish]
- Indocatum
- Indocatum [INN-Latin]
- K 281
- Unii-78D9U89Tbg
- 1H-Indole-5-carboxylic acid, 2,3-dimethyl-1-(phenylmethyl)-, 2-(dimethylamino)ethyl ester
- 2-(Dimethylamino)ethyl 1-benzyl-2,3-dimethylindole-5-carboxylate
- 2-(dimethylamino)ethyl 1-benzyl-2,3-dimethyl-1H-indole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Indocate
CAS:Indocate is a bioactive chemical.Formula:C22H26N2O2Color and Shape:SolidMolecular weight:350.45
