CAS 31387-49-2
:Benzoic acid, 3,4,5-trihydroxy-, homopolymer
Description:
Benzoic acid, 3,4,5-trihydroxy-, homopolymer, identified by CAS number 31387-49-2, is a polymer derived from the polymerization of a benzoic acid derivative featuring three hydroxyl groups at the 3, 4, and 5 positions on the aromatic ring. This structure imparts unique properties, including increased solubility in water compared to many other benzoic acid derivatives, due to the presence of multiple hydroxyl groups that can form hydrogen bonds. The polymer exhibits potential applications in various fields, including pharmaceuticals, food preservation, and as a stabilizer in cosmetic formulations, owing to its biocompatibility and ability to interact with other substances. Additionally, the presence of hydroxyl groups enhances its reactivity, allowing for further chemical modifications. The polymer's physical properties, such as molecular weight and viscosity, can vary significantly depending on the polymerization conditions and the degree of polymerization. Overall, this compound represents a versatile material with potential utility in diverse applications due to its functional groups and polymeric nature.
Formula:(C7H6O5)x
InChI:InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12)
InChI key:InChIKey=LNTHITQWFMADLM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(O)=C(O)C(O)=C1
Synonyms:- Gallic acid, polymers
- Gallic acid polymer
- Benzoic acid, 3,4,5-trihydroxy-, homopolymer
- Gallic acid homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
