CAS 31402-54-7

5-bromo-N-methylpyrimidin-2-amine

Description:

5-Bromo-N-methylpyrimidin-2-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a methylamino group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. The bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the presence of the methyl group can affect the compound's steric and electronic properties, potentially impacting its reactivity and binding affinity in various chemical reactions. As with many nitrogen-containing heterocycles, it may participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis.

Formula: C₅H₆BrN₃

InChI: InChI=1/C5H6BrN3/c6-4-2-8-5(1-7)9-3-4/h2-3H,1,7H2

SMILES: C(c1ncc(cn1)Br)N

Synonyms:

• 2-pyrimidinamine, 5-bromo-N-methyl-
• 5-Bromo-N-methyl-2-pyrimidinamine
• T6N Cnj Bm1 Ee [Wln]

5-Bromo-2-(methylamino)pyrimidine

CAS: 31402-54-7

Formula: C₅H₆BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0252

Ref: IN-DA00BZH0

5-Bromo-2-(methylamino)pyrimidine

CAS: 31402-54-7

5-Bromo-2-(methylamino)pyrimidine

Purity: 98%

Color and Shape: Powder

Molecular weight: 188.03g/mol

Ref: 54-OR7851

5-Bromo-2-(methylamino)pyrimidine

CAS: 31402-54-7

Purity: 98%

Molecular weight: 188.03

Ref: FT-B1746

5-Bromo-N-methylpyrimidin-2-amine

CAS: 31402-54-7

Formula: C₅H₆BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.028

Ref: 10-F210036