CAS 314036-11-8

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]phenol

Description:

2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]phenol, identified by its CAS number 314036-11-8, is a chemical compound that features a benzisothiazole moiety with a dioxido group and an amino group linked to a phenolic structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzisothiazole ring, which is known for its antimicrobial and antifungal properties. The phenolic group contributes to its reactivity and potential as an antioxidant. The dioxido group may enhance its solubility and stability in various solvents. This compound is of interest in medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific applications and behavior in biological systems would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. Safety data and handling precautions should be consulted due to the potential toxicity associated with similar compounds.

Formula: C₁₃H₁₀N₂O₃S

InChI: InChI=1S/C13H10N2O3S/c16-11-7-3-2-6-10(11)14-13-9-5-1-4-8-12(9)19(17,18)15-13/h1-8,16H,(H,14,15)

InChI key: InChIKey=ZVEMGZCIQSPWEG-UHFFFAOYSA-N

SMILES: N(C=1C=2C(S(=O)(=O)N1)=CC=CC2)C3=C(O)C=CC=C3

Synonyms:

• 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]phenol
• Phenol, 2-[(1,1-dioxido-1,2-benzisothiazol-3-yl)amino]-

2-[(1,1-dioxido-1,2-benzisothiazol-3-yl)amino]phenol

CAS: 314036-11-8

Molecular weight: 274.2900085449219

Ref: 10-F369366