CAS 314041-52-6

2-hydroxy-6,7-dimethyl-4H-chromen-4-one

Description:

2-Hydroxy-6,7-dimethyl-4H-chromen-4-one, also known as a flavonoid compound, exhibits several notable characteristics. This substance features a chromone backbone, which is a fused benzopyran structure, and is characterized by the presence of hydroxyl (-OH) and methyl (-CH3) substituents. The hydroxyl group contributes to its potential antioxidant properties, while the methyl groups can influence its solubility and biological activity. This compound is typically soluble in organic solvents and may exhibit varying degrees of solubility in water, depending on the pH. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of natural products with anti-inflammatory, antimicrobial, or anticancer activities. Additionally, the presence of the hydroxyl group may enhance its reactivity and ability to form complexes with metal ions. Overall, 2-hydroxy-6,7-dimethyl-4H-chromen-4-one represents a class of compounds that are of significant interest in both medicinal chemistry and natural product research.

Formula: C₁₁H₁₀O₃

InChI: InChI=1/C11H10O3/c1-6-3-8-9(12)5-11(13)14-10(8)4-7(6)2/h3-5,13H,1-2H3

SMILES: Cc1cc2c(=O)cc(O)oc2cc1C

6,7-Dimethyl-4-hydroxycoumarin hydrate

CAS: 314041-52-6

6,7-Dimethyl-4-hydroxycoumarin hydrate

Purity: ≥95%

Molecular weight: 208.21g/mol

Ref: 54-OR351008