CAS 314042-69-8

4-[[(4-Methylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid

Description:

4-[[(4-Methylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid, with the CAS number 314042-69-8, is a chemical compound characterized by its unique structure that includes a cyclohexane ring, a carboxylic acid functional group, and a sulfonamide moiety. This compound features a para-methylphenyl group attached to a sulfonyl group, which contributes to its potential biological activity. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The sulfonamide group is known for its role in medicinal chemistry, often contributing to the pharmacological properties of compounds. Additionally, the cyclohexane ring provides a degree of rigidity and can influence the compound's conformation and interactions with biological targets. Overall, this compound may have applications in pharmaceuticals or as a biochemical tool, although specific biological activities would require further investigation.

Formula: C₁₄H₁₉NO₄S

InChI: InChI=1S/C14H19NO4S/c1-10-2-8-13(9-3-10)20(18,19)15-12-6-4-11(5-7-12)14(16)17/h2-3,8-9,11-12,15H,4-7H2,1H3,(H,16,17)

InChI key: InChIKey=PKHCQZVVYAPDCE-UHFFFAOYSA-N

SMILES: S(NC1CCC(C(O)=O)CC1)(=O)(=O)C2=CC=C(C)C=C2

Synonyms:

• 4-[[(4-Methylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[[(4-methylphenyl)sulfonyl]amino]-

4-(Toluene-4-sulfonylamino)-cyclohexanecarboxylic acid

CAS: 314042-69-8

Formula: C₁₄H₁₉NO₄S

Purity: 98%

Color and Shape: No data available.

Molecular weight: 297.37

Ref: 10-F028937