CAS 31406-67-4
:tetrabenzylhafnium
Description:
Tetrabenzylhafnium is an organometallic compound characterized by its coordination of hafnium with four benzyl groups. It typically appears as a colorless to pale yellow solid and is known for its stability under inert conditions. The compound features hafnium in a +4 oxidation state, which is common for many hafnium complexes. Tetrabenzylhafnium is notable for its potential applications in organic synthesis and materials science, particularly in the development of hafnium-based catalysts and precursors for hafnium oxide thin films. Its solubility in organic solvents makes it useful in various chemical reactions. Additionally, the presence of the benzyl groups enhances its reactivity and facilitates interactions with other organic molecules. However, like many organometallic compounds, it should be handled with care due to potential toxicity and reactivity with moisture or air. Overall, tetrabenzylhafnium exemplifies the unique properties of organometallic compounds, bridging the gap between metal chemistry and organic synthesis.
Formula:C28H28Hf
InChI:InChI=1/4C7H7.Hf/c4*1-7-5-3-2-4-6-7;/h4*2-6H,1H2;/rC28H28Hf/c1-5-13-25(14-6-1)21-29(22-26-15-7-2-8-16-26,23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28/h1-20H,21-24H2
SMILES:c1ccc(cc1)C[Hf](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tetrabenzylhafnium, min. 97%
CAS:Tetrabenzylhafnium, min. 97%
Formula:(C6H5CH2)4HfPurity:min. 97%Color and Shape:yellow pwdr.Molecular weight:543.01Tetrabenzylhafnium
CAS:Controlled ProductTetrabenzylhafnium is a boron-containing organometallic compound that reacts with styrene to form crosslinked polymers. The polymerization of styrene can be initiated by chain reactions that are activated by metal cations, such as magnesium. Tetrabenzylhafnium can also form coordination complexes with boronic esters, which forms patterns on the surface of zirconium.
Formula:C28H28HfPurity:Min. 95%Molecular weight:543.01 g/mol
