CAS 314062-46-9
:cis-2,3-diphenyl-1-propylaziridine
Description:
Cis-2,3-diphenyl-1-propylaziridine is a cyclic organic compound characterized by its aziridine ring, which consists of a three-membered nitrogen-containing heterocycle. The "cis" designation indicates that the two phenyl groups attached to the aziridine ring are oriented on the same side, influencing the compound's stereochemistry and potentially its reactivity. The presence of the propyl group contributes to the overall hydrophobic character of the molecule. This compound may exhibit interesting chemical properties, such as reactivity in nucleophilic substitutions or ring-opening reactions due to the strained nature of the aziridine ring. Additionally, the phenyl substituents can provide sites for further functionalization or interaction with other molecules. The compound's unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its physical properties, such as solubility, boiling point, and stability, would be necessary to fully understand its behavior in various environments.
Formula:C17H19N
InChI:InChI=1/C17H19N/c1-2-13-18-16(14-9-5-3-6-10-14)17(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17+,18?
Synonyms:- (2R,3S)-2,3-diphenyl-1-propylaziridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
