CAS 31407-29-1

2-Amino-3-quinolinecarboxylic acid

Description:

2-Amino-3-quinolinecarboxylic acid, with the CAS number 31407-29-1, is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the quinoline ring, contributing to its acidic and basic properties. It is typically a crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex molecules. The presence of both the amino and carboxylic acid functional groups allows for diverse reactivity, making it a versatile compound in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1S/C10H8N2O2/c11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9/h1-5H,(H2,11,12)(H,13,14)

InChI key: InChIKey=PUBYDOJONNWFJJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(N=C1N)C=CC=C2

Synonyms:

• NSC 138302
• 2-Amino-3-quinolinecarboxylic acid
• 3-Quinolinecarboxylic acid, 2-amino-

2-Aminoquinoline-3-carboxylic acid

CAS: 31407-29-1

Formula: C₁₀H₈N₂O₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA00CB2H

2-Aminoquinoline-3-carboxylic acid

CAS: 31407-29-1

2-Aminoquinoline-3-carboxylic acid is a heterocyclic compound that contains a carboxylic group and a cyano group. It is used in research as a trackable cation. 2-Aminoquinoline-3-carboxylic acid has been shown to inhibit the binding of chloride ions to the cytoplasmic membrane, which decreases the permeability of the membrane to chloride ions, thus inhibiting its transport into cells. This compound also inhibits nitric oxide synthase and exhibits anti-inflammatory effects by suppressing cytokine release from macrophages. 2-Aminoquinoline-3-carboxylic acid may be synthesized from 2 amino quinolines and chlorides.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.18 g/mol

Ref: 3D-GBA40729