CymitQuimica logo

CAS 3141-25-1

:

2,3,4-Tribromothiophene

Description:
2,3,4-Tribromothiophene is a brominated derivative of thiophene, a five-membered aromatic heterocyclic compound containing sulfur. This substance features three bromine atoms substituted at the 2, 3, and 4 positions of the thiophene ring, which significantly influences its chemical properties and reactivity. It is typically a solid at room temperature and exhibits a characteristic aromatic odor. The presence of bromine atoms enhances its electrophilic character, making it reactive in various chemical reactions, such as nucleophilic substitutions and coupling reactions. 2,3,4-Tribromothiophene is often utilized in organic synthesis and materials science, particularly in the development of organic semiconductors and conducting polymers. Its solubility in organic solvents allows for ease of handling in laboratory settings. Additionally, the compound's electronic properties can be tuned through further functionalization, making it a valuable building block in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks.
Formula:C4HBr3S
InChI:InChI=1S/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H
InChI key:InChIKey=ZDXQFDMBZUQHOM-UHFFFAOYSA-N
SMILES:BrC=1C(Br)=CSC1Br
Synonyms:
  • Thiophene, 2,3,4-tribromo-
  • 2,3,4-Tribromothiophene
Found 3 products.