CAS 314266-76-7
:N-{(2R,4S,5S)-5-[(L-alpha-aspartyl-L-valyl-L-asparaginyl)amino]-4-hydroxy-2,7-dimethyloctanoyl}-L-alanyl-L-alpha-aspartyl-L-phenylalanine
Description:
The chemical substance with the name "N-{(2R,4S,5S)-5-[(L-alpha-aspartyl-L-valyl-L-asparaginyl)amino]-4-hydroxy-2,7-dimethyloctanoyl}-L-alanyl-L-alpha-aspartyl-L-phenylalanine" and CAS number 314266-76-7 is a complex peptide compound. It features a specific stereochemistry, indicated by the R and S designations, which are crucial for its biological activity. The structure includes multiple amino acid residues, such as L-alpha-aspartic acid, L-valine, L-asparagine, and L-phenylalanine, contributing to its potential role in biochemical processes. The presence of a hydroxy group and a dimethyl octanoyl chain suggests that it may have unique solubility and stability characteristics, which can influence its interaction with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of peptide-based therapeutics or as a model for studying peptide interactions. Its specific properties, such as solubility, stability, and biological activity, would need to be characterized through experimental studies to fully understand its potential applications.
Formula:C39H60N8O14
InChI:InChI=1/C39H60N8O14/c1-18(2)12-24(43-36(57)25(16-29(41)49)45-38(59)32(19(3)4)47-35(56)23(40)15-30(50)51)28(48)13-20(5)33(54)42-21(6)34(55)44-26(17-31(52)53)37(58)46-27(39(60)61)14-22-10-8-7-9-11-22/h7-11,18-21,23-28,32,48H,12-17,40H2,1-6H3,(H2,41,49)(H,42,54)(H,43,57)(H,44,55)(H,45,59)(H,46,58)(H,47,56)(H,50,51)(H,52,53)(H,60,61)/t20-,21+,23+,24+,25+,26+,27+,28+,32+/m1/s1
Synonyms:- Om99-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
OM99-2
CAS:OM99-2, EVNL-psi[CHOH-CH₂]-AAEF-NH₂, is a potent inhibitor for human brain memapsin-2 (β-secretase) containing a Leu-Ala hydroxyethylene isostere with a Ki-value of 9.58 · 10⁻⁹ M.Formula:C41H64N8O14Purity:>97%Color and Shape:White PowderMolecular weight:893.01OM99-2
CAS:OM99-2, an 8-residue peptidomimetic, binds memapsin 2 with 9.58 nM Ki; promising for Alzheimer's research.Formula:C41H64N8O14Color and Shape:SolidMolecular weight:893.005Glu-Val-Asn-[(2R,4S,5S)-5-amino-4-hydroxy-2,7-dimethyloctanoyl]-Ala-Glu-Phe
CAS:Formula:C41H64N8O14Molecular weight:892.99OM99-2trifluoroacetate salt
CAS:Please enquire for more information about OM99-2trifluoroacetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C41H64N8O14Purity:Min. 95%Molecular weight:892.99 g/mol



