CAS 314272-99-6: N-(4-bromophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide
Description:N-(4-bromophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide, with the CAS number 314272-99-6, is a synthetic organic compound characterized by its chromene core structure, which is a fused benzopyran system. This compound features a carboxamide functional group, contributing to its potential biological activity. The presence of a methoxy group at the 6-position and a bromophenyl substituent at the 4-position enhances its chemical reactivity and solubility properties. The chromene moiety is known for its diverse pharmacological activities, including anti-inflammatory and antioxidant effects. The compound's molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its stability and solubility in organic solvents can facilitate its use in various applications, including drug development and research. Overall, this compound exemplifies the complexity and utility of heterocyclic compounds in the field of organic chemistry.
Formula:C17H12BrNO4
InChI:InChI=1/C17H12BrNO4/c1-22-13-6-7-15-10(8-13)9-14(17(21)23-15)16(20)19-12-4-2-11(18)3-5-12/h2-9H,1H3,(H,19,20)
- Synonyms:
- 2H-1-benzopyran-3-carboxamide, N-(4-bromophenyl)-6-methoxy-2-oxo-
- N-(4-Bromophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-(4-Bromophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide REF: 3D-PMA27299CAS: 314272-99-6 | Min. 95% | - - - | Discontinued product |

N-(4-Bromophenyl)-6-methoxy-2-oxo-2H-chromene-3-carboxamide
Ref: 3D-PMA27299
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |