CAS 314280-18-7

2-Thienyl-N,N-bis(2-thienylmethylene)methanediamine

Description:

2-Thienyl-N,N-bis(2-thienylmethylene)methanediamine is an organic compound characterized by its unique structure, which includes two thienyl groups and a methanediamine backbone. The thienyl groups, derived from thiophene, contribute to the compound's aromaticity and potential electronic properties. This compound is likely to exhibit properties typical of thienyl derivatives, such as increased stability and reactivity due to the presence of sulfur in the thiophene rings. The methanediamine component introduces amine functionalities, which can participate in hydrogen bonding and may enhance solubility in polar solvents. Additionally, the presence of multiple thienyl groups may impart interesting optical and electronic characteristics, making it a candidate for applications in organic electronics or as a ligand in coordination chemistry. Its synthesis and reactivity can be influenced by the substituents on the thienyl rings, which can affect its overall chemical behavior. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₂N₂S₃

InChI: InChI=1/C15H12N2S3/c1-4-12(18-7-1)10-16-15(14-6-3-9-20-14)17-11-13-5-2-8-19-13/h1-11,15H/b16-10+,17-11+