CAS 31450-14-3
:gamma-linolenic acid ethyl ester
Description:
Gamma-linolenic acid ethyl ester (GLEE) is an ester derived from gamma-linolenic acid, a polyunsaturated fatty acid. It is characterized by its long carbon chain, which typically contains 18 carbon atoms and three double bonds, specifically in the omega-6 position. GLEE is a colorless to pale yellow liquid at room temperature and is soluble in organic solvents but has limited solubility in water. This compound is known for its potential health benefits, including anti-inflammatory properties and its role in promoting skin health. It is often used in dietary supplements and cosmetic formulations due to its ability to enhance skin barrier function and moisture retention. The presence of multiple double bonds in its structure contributes to its reactivity and susceptibility to oxidation, necessitating proper storage conditions to maintain stability. Additionally, gamma-linolenic acid ethyl ester is of interest in various fields, including nutrition and pharmacology, for its potential therapeutic applications.
Formula:C20H34O2
InChI:InChI=1/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h8-9,11-12,14-15H,3-7,10,13,16-19H2,1-2H3/b9-8-,12-11-,15-14-
SMILES:CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OCC
Synonyms:- ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Ethyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate
CAS:Formula:C20H34O2Purity:95%Color and Shape:LiquidMolecular weight:306.4828Ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate
CAS:Ethyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoatePurity:95%Molecular weight:306.49g/molEthyl 6(Z),9(Z),12(Z)-octadecatrienoate
CAS:Formula:C20H34O2Purity:>99%Color and Shape:LiquidMolecular weight:306.48γ-Linolenic Acid Ethyl Ester-d5
CAS:Controlled ProductFormula:C20H29D5O2Color and Shape:NeatMolecular weight:311.51γ-Linolenic Acid Ethyl Ester
CAS:Controlled ProductFormula:C20H34O2Color and Shape:NeatMolecular weight:306.48γ-Linolenic acid ethyl ester
CAS:<p>γ-Linolenic acid ethyl ester (Ethyl γ-linolenate) is a leukotriene B 4 receptor 4 (LTB 4 ) antagonist which has a potential anti-inflammatory effect[1].</p>Formula:C20H34O2Color and Shape:SolidMolecular weight:306.48







