CAS 31454-24-7

2-Propenoic acid, [1,1′-biphenyl]-4-yl ester, homopolymer

Description:

2-Propenoic acid, [1,1′-biphenyl]-4-yl ester, homopolymer, commonly referred to as a polymer derived from the ester of acrylic acid and biphenyl, exhibits several notable characteristics. This substance is a synthetic polymer that typically features a high degree of thermal stability and resistance to chemical degradation, making it suitable for various applications in coatings, adhesives, and plastics. The presence of the biphenyl moiety contributes to its rigidity and enhances its mechanical properties, such as tensile strength and impact resistance. Additionally, this polymer may exhibit good UV stability, which is beneficial for outdoor applications. Its solubility can vary depending on the molecular weight and the specific formulation, but it generally shows compatibility with a range of organic solvents. The polymerization process can be initiated through various methods, including radical polymerization, which allows for control over molecular weight and structure. Overall, this compound is valued for its versatility and performance in industrial applications.

Formula: (C₁₅H₁₂O₂)x

InChI: InChI=1S/C15H12O2/c1-2-15(16)17-14-10-8-13(9-11-14)12-6-4-3-5-7-12/h2-11H,1H2

InChI key: InChIKey=LAOHSTYFUKBMQN-UHFFFAOYSA-N

SMILES: O(C(C=C)=O)C1=CC=C(C=C1)C2=CC=CC=C2

Synonyms:

• Poly(p-biphenylyl acrylate)
• Poly(p-biphenyl acrylate)
• 2-Propenoic acid, [1,1′-biphenyl]-4-yl ester, homopolymer
• Acrylic acid, 4-biphenylyl ester, polymers
• 4-Biphenylol, acrylate, polymers

2-Propenoic acid, [1,1′-biphenyl]-4-yl ester, homopolymer

CAS: 31454-24-7

Formula: C₁₅H₁₂O₂

Molecular weight: 224.2546

Ref: IN-DA0011O8