CAS 31458-36-3: 6-Fluoro-5-methyl-2,4(1H,3H)-pyrimidinedione

Description:6-Fluoro-5-methyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 31458-36-3, is a heterocyclic organic compound characterized by a pyrimidine ring structure that contains both a fluorine atom and a methyl group. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in medicinal chemistry. The fluorine substitution at the 6-position can enhance the compound's biological activity and lipophilicity, making it of interest in drug design. The methyl group at the 5-position can influence the compound's steric and electronic properties. Generally, pyrimidinediones are known for their diverse biological activities, including antimicrobial and antitumor properties. The specific characteristics of 6-Fluoro-5-methyl-2,4(1H,3H)-pyrimidinedione, such as its solubility, melting point, and stability, would depend on its molecular interactions and the presence of functional groups, making it a subject of interest for further research in pharmaceutical applications.

Formula:C₅H₅FN₂O₂

InChI:InChI=1S/C5H5FN2O2/c1-2-3(6)7-5(10)8-4(2)9/h1H3,(H2,7,8,9,10)

InChI key:InChIKey=YDRTVDABIUUNKS-UHFFFAOYSA-N

SMILES:O=C1NC(=O)C(=C(F)N1)C