CAS 3146-50-7
:D-glycero-D-gulo-Heptose
Description:
D-glycero-D-gulo-heptose is a seven-carbon sugar, specifically a heptose, that belongs to the class of monosaccharides. It is an aldoheptose, meaning it contains an aldehyde functional group. This compound is characterized by its specific stereochemistry, which is defined by the configuration of hydroxyl groups around its carbon backbone. D-glycero-D-gulo-heptose plays a significant role in the biosynthesis of lipopolysaccharides in certain bacteria, contributing to their structural integrity and pathogenicity. The presence of this sugar in bacterial cell walls is crucial for their interaction with host organisms. In terms of physical properties, D-glycero-D-gulo-heptose is typically a white crystalline solid that is soluble in water, reflecting the hydrophilic nature of sugars. Its reactivity is influenced by the functional groups present, allowing it to participate in various biochemical pathways. Overall, D-glycero-D-gulo-heptose is an important sugar in microbiology and biochemistry, with implications for understanding bacterial physiology and developing antimicrobial strategies.
Formula:C7H14O7
InChI:InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4+,5-,6+,7+/m0/s1
InChI key:InChIKey=YPZMPEPLWKRVLD-PJEQPVAWSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@H]([C@H](C=O)O)O)O
Synonyms:- D-glycero-D-gulo-Heptose
- α-gluco-Heptose
- NSC 2555
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
D-glycero-D-gulo-Heptose
CAS:Controlled ProductFormula:C7H14O7Color and Shape:NeatMolecular weight:185.2
