CAS 31461-61-7
:glu-val-phe
Description:
Glu-Val-Phe, also known as glutamyl-valyl-phenylalanine, is a tripeptide composed of three amino acids: glutamic acid (Glu), valine (Val), and phenylalanine (Phe). It is characterized by its specific sequence of amino acids, which influences its biochemical properties and potential biological activities. The peptide exhibits properties typical of peptides, including solubility in water and the ability to form hydrogen bonds due to the presence of polar side chains. Glu-Val-Phe may play a role in various biological processes, including signaling pathways and protein synthesis. Its CAS number, 31461-61-7, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. The tripeptide's structure allows it to interact with specific receptors and enzymes, potentially influencing physiological functions. As with many peptides, its stability and activity can be affected by factors such as pH, temperature, and the presence of other molecules. Further research may uncover additional applications in fields such as biochemistry, pharmacology, and nutrition.
Formula:C19H27N3O6
InChI:InChI=1/C19H27N3O6/c1-11(2)16(22-17(25)13(20)8-9-15(23)24)18(26)21-14(19(27)28)10-12-6-4-3-5-7-12/h3-7,11,13-14,16H,8-10,20H2,1-2H3,(H,21,26)(H,22,25)(H,23,24)(H,27,28)/t13-,14-,16-/m0/s1
SMILES:CC(C)[C@@H](C(=N[C@@H](Cc1ccccc1)C(=O)O)O)N=C([C@H](CCC(=O)O)N)O
Synonyms:- H-Glu-Val-Phe-OH
- L-alpha-glutamyl-L-valyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-4-Amino-5-(((S)-1-(((S)-1-carboxy-2-phenylethyl)amino)-3-methyl-1-oxobutan-2-yl)amino)-5-oxopentanoic acid
CAS:Formula:C19H27N3O6Molecular weight:393.4342H-Glu-Val-Phe-OH
CAS:H-Glu-Val-Phe-OH is a cytosolic protein that has been shown to react with a number of reactive oxygen species. It reacts with electrons by forming a disulfide bond, which can be reduced back to the original molecule by the addition of an electron donor. This chemical reaction may be important in radiation or chemical toxicity. H-Glu-Val-Phe-OH has been used as a monoclonal antibody in pharmacokinetic modeling and pharmacodynamic studies, and has been shown to have low clearance and high volume of distribution, suggesting that this protein is concentrated in the cytosol. H-Glu-Val-Phe-OH also has pharmacokinetic properties that are not well understood, but it is thought to be eliminated from the body at a rate similar to ornithine.Formula:C19H27N3O6Purity:Min. 95%Molecular weight:393.43 g/mol

