CAS 31461-63-9

gly-lys hydrochloride

Description:

Gly-Lys hydrochloride, also known as glycyl-lysine hydrochloride, is a dipeptide composed of the amino acids glycine and lysine, linked by a peptide bond. It is typically found as a white to off-white crystalline powder and is soluble in water, making it suitable for various biochemical applications. The presence of the hydrochloride indicates that it is in its salt form, which enhances its stability and solubility. Gly-Lys hydrochloride is often used in peptide synthesis, research, and as a potential supplement in nutrition due to its role in protein synthesis and cellular functions. Its molecular structure contributes to its properties, including its ability to participate in various biochemical reactions. Additionally, it may exhibit biological activities, such as promoting muscle growth and recovery, although specific effects can vary based on concentration and context. As with any chemical substance, proper handling and storage conditions are essential to maintain its integrity and efficacy.

Formula: C₈H₁₈ClN₃O₃

InChI: InChI=1/C8H17N3O3.ClH/c9-4-2-1-3-6(8(13)14)11-7(12)5-10;/h6H,1-5,9-10H2,(H,11,12)(H,13,14);1H

SMILES: C(CCN)CC(C(=O)O)N=C(CN)O.Cl

Synonyms:

• H-Gly-Lys-OH . HCl

H-Gly-Lys-OH · HCl

CAS: 31461-63-9

Bachem ID: 4000112.

Formula: C₈H₁₇N₃O₃·HCl

Purity: > 99%

Color and Shape: White Powder

Molecular weight: 239.7

Ref: 01-4000112

H-Gly-Lys-OH·HCl

CAS: 31461-63-9

Please enquire for more information about H-Gly-Lys-OH·HCl including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₁₇N₃O₃·HCl

Purity: Min. 95%

Molecular weight: 239.7 g/mol

Ref: 3D-FG108237