CAS 31462-59-6

4-Pyrimidinecarboxylic acid

Description:

4-Pyrimidinecarboxylic acid, also known as 4-pyrimidinecarboxylic acid or simply pyrimidine-4-carboxylic acid, is an organic compound characterized by a pyrimidine ring with a carboxylic acid functional group at the 4-position. Its molecular formula is C6H6N2O2, and it features a heterocyclic structure that includes nitrogen atoms within the aromatic ring. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which makes it useful in various chemical applications. 4-Pyrimidinecarboxylic acid is often utilized in the synthesis of pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its properties include moderate acidity due to the carboxylic group, and it can participate in various chemical reactions such as esterification and amidation. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, following appropriate safety protocols.

Formula: C₅H₄N₂O₂

InChI: InChI=1S/C5H4N2O2/c8-5(9)4-1-2-6-3-7-4/h1-3H,(H,8,9)

InChI key: InChIKey=YPOXGDJGKBXRFP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=CN=CN1

Synonyms:

• 4-Pyrimidinecarboxylic acid

Pyrimidine-4-carboxylic acid, 97%

CAS: 31462-59-6

Formula: C5H4N2O2

Color and Shape: White - yellow - Brown Crystal - Powder

Molecular weight: 124.10

Ref: BD-BD20162

Pyrimidine-4-carboxylic acid

CAS: 31462-59-6

Formula: C₅H₄N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.0975

Ref: IN-DA003U2Y

Pyrimidine-4-carboxylic acid

CAS: 31462-59-6

Pyrimidine-4-carboxylic acid

Formula: C₅H₄N₂O₂

Purity: ≥95%

Color and Shape: very dark red/brown solid

Molecular weight: 124.10g/mol

Ref: 54-OR3737

Pyrimidine-4-carboxylic acid

CAS: 31462-59-6

Formula: C₅H₄N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 124.099

Ref: 10-F066253