CAS 31466-48-5
:2-(4-ethoxyphenyl)-2-(morpholin-4-yl)ethanamine
Description:
2-(4-Ethoxyphenyl)-2-(morpholin-4-yl)ethanamine, identified by its CAS number 31466-48-5, is an organic compound characterized by its unique molecular structure, which includes an ethoxy group and a morpholine ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The ethoxyphenyl moiety contributes to its hydrophobic characteristics, while the morpholine ring enhances its solubility in polar solvents. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its potential applications could include roles as a pharmaceutical agent or in the development of new therapeutic compounds. The stability and reactivity of this substance can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2-(4-ethoxyphenyl)-2-(morpholin-4-yl)ethanamine is a compound with diverse chemical properties that warrant further investigation for its potential applications.
Formula:C14H22N2O2
InChI:InChI=1/C14H22N2O2/c1-2-18-13-5-3-12(4-6-13)14(11-15)16-7-9-17-10-8-16/h3-6,14H,2,7-11,15H2,1H3
SMILES:CCOc1ccc(cc1)C(CN)N1CCOCC1
Synonyms:- 2-(4-Ethoxyphenyl)-2-Morpholin-4-Ylethanamine
- 31466-48-5
- 4-Morpholineethanamine, Β-(4-Ethoxyphenyl)-
- 2-(4-Ethoxyphenyl)-2-(morpholin-4-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.