CAS 3147-18-0
:Pheophytin b
Description:
Pheophytin b is a chlorophyll derivative, specifically a type of pheophytin, which is a pigment involved in photosynthesis. It is characterized by its dark green color and is primarily found in plants, where it plays a crucial role in the light-harvesting process. Pheophytin b is formed when the magnesium ion in chlorophyll is replaced by two hydrogen ions, resulting in a more stable structure that can participate in electron transfer during photosynthesis. This compound is soluble in organic solvents and has a relatively low solubility in water, which is typical for chlorophyll derivatives. Its molecular structure includes a porphyrin ring, contributing to its ability to absorb light in the visible spectrum, particularly in the blue and red regions. Pheophytin b is often studied in the context of plant physiology and biochemistry, as it is essential for understanding the mechanisms of energy conversion in photosynthetic organisms. Additionally, it has applications in research related to environmental science and the study of plant health.
Formula:C55H72N4O6
InChI:InChI=1S/C55H72N4O6/c1-12-38-35(8)42-27-43-36(9)40(23-24-48(61)65-26-25-34(7)22-16-21-33(6)20-15-19-32(5)18-14-17-31(3)4)52(58-43)50-51(55(63)64-11)54(62)49-37(10)44(59-53(49)50)28-46-39(13-2)41(30-60)47(57-46)29-45(38)56-42/h12,25,27-33,36,40,51,56,59H,1,13-24,26H2,2-11H3/b34-25+,42-27?,43-27-,44-28-,45-29?,46-28?,47-29-,52-50?/t32-,33-,36+,40+,51-/m1/s1
InChI key:InChIKey=ZQGOYEJYAYJFTL-WSNWOQFWSA-N
SMILES:C(OC)(=O)[C@@H]1C=2C3=C(C1=O)C(C)=C(N3)C=C4C(CC)=C(C=O)C(=N4)C=C5NC(=CC6=NC2[C@@H](CCC(OC/C=C(/CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)\C)=O)[C@@H]6C)C(C)=C5C=C
Synonyms:- 3,7,11,15-Tetramethylhexadec-2-en-1-yl (3S(3alpha(2E,7S*,11S*),4beta,21beta)-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-9-vinylphorbine-3-propionate
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-yl ester, (3S,4S,21R)-
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-, (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl ester, (3S,4S,21R)-
- 3-Phorbinepropanoic acid, 9-ethenyl-14-ethyl-13-formyl-21-(methoxycarbonyl)-4,8,18-trimethyl-20-oxo-, 3,7,11,15-tetramethyl-2-hexadecenyl ester, [3S-[3α(2E,7S*,11S*),4β,21β]]-
- 3-Phorbinepropionic acid, 21-carboxy-14-ethyl-13-formyl-4,8,18-trimethyl-20-oxo-9-vinyl-, 21-methyl 3-phytyl ester, (E)-
- Chlorophyllic acid b
- Phaeophytin b
- Pheophytin b
- methyl (3S,4S,21R)-9-ethenyl-14-ethyl-13-formyl-4,8,18-trimethyl-20-oxo-3-(3-oxo-3-{[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]oxy}propyl)phorbine-21-carboxylate
- methyl 9-ethenyl-14-ethyl-13-formyl-4,8,18-trimethyl-20-oxo-3-(3-oxo-3-{[(2E)-3,7,11,15-tetramethylhexadec-2-en-1-yl]oxy}propyl)-24,25-dihydrophorbine-21-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Pheophytin B
CAS:<p>Pheophytin B is a chlorophyll derivative, which is a pigment molecule sourced from plants, specifically a part of the photosynthetic apparatus. During chlorophyll breakdown, the magnesium ion is replaced by two hydrogen atoms, forming pheophytin. This structural modification results in the loss of the central magnesium ion, altering its absorption properties and functionality.</p>Formula:C55H72N4O6Purity:Min. 95%Molecular weight:885.18 g/mol
