CAS 3147-45-3
:4-Hydroxysalicylamide
Description:
4-Hydroxysalicylamide, with the CAS number 3147-45-3, is an organic compound that features both hydroxyl and amide functional groups. It is derived from salicylic acid, where the hydroxyl group is positioned at the 4th carbon relative to the amide group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of the hydroxyl group contributes to its potential as a chelating agent, allowing it to interact with metal ions. 4-Hydroxysalicylamide is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential biological activities, such as anti-inflammatory and antimicrobial properties. Its structural characteristics enable it to participate in various chemical reactions, making it a valuable compound for synthetic organic chemistry. As with many organic compounds, proper handling and safety precautions should be observed, as it may pose health risks if ingested or improperly managed.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c8-7(11)5-2-1-4(9)3-6(5)10/h1-3,9-10H,(H2,8,11)
InChI key:InChIKey=IIUJCQYKTGNRHH-UHFFFAOYSA-N
SMILES:c1cc(c(cc1O)O)C(=N)O
Synonyms:- 1,3,4-Resorcylic acid amide
- 2,4-Dihydroxybenzamide
- Benzamide, 2,4-dihydroxy-
- NSC 60728
- β-Resorcylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Dihydroxybenzamide
CAS:Formula:C7H7NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Light gray to Light orange powder to crystalMolecular weight:153.142-Hydroxysalicylamide
CAS:2-Hydroxysalicylamide is a low-energy, small molecule that has shown to be an effective inhibitor of serine proteases. It binds to the active site of the protease, blocking catalysis and inhibiting the growth of cancer cells. 2-Hydroxysalicylamide has been shown to inhibit the transcriptional regulation of pro-inflammatory genes in a patterning assay and it inhibits tumor growth in a pain model. This drug also suppresses the expression of suppressor genes and can be used as an analgesic without causing side effects.
2-Hydroxysalicylamide is also a polarizer for tissues, meaning that it preferentially accumulates in tissues with high water content such as breast tissue. This property has been shown to be useful for imaging cancerous tumors.Formula:C7H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:153.14 g/mol




