CAS 3147-58-8

1,3-Dihydroxy-2-Naphthoic Acid

Description:

1,3-Dihydroxy-2-naphthoic acid, with the CAS number 3147-58-8, is an organic compound characterized by its naphthalene structure, which features two hydroxyl groups at the 1 and 3 positions and a carboxylic acid group at the 2 position. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and higher solubility in organic solvents such as ethanol and acetone. It is known for its ability to act as a chelating agent, forming complexes with metal ions, which can be useful in various applications, including analytical chemistry and materials science. The presence of hydroxyl groups contributes to its acidity and reactivity, making it a valuable intermediate in organic synthesis. Additionally, 1,3-dihydroxy-2-naphthoic acid may exhibit biological activity, although specific pharmacological properties would require further investigation. Its structural features and functional groups make it a compound of interest in both industrial and research settings.

Formula: C₁₁H₈O₄

InChI: InChI=1S/C11H8O4/c12-8-5-6-3-1-2-4-7(6)10(13)9(8)11(14)15/h1-5,12-13H,(H,14,15)

InChI key: USZZLTVYRPLBMB-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C=C(C(=C2O)C(=O)O)O

Synonyms:

• 1,3-dihydroxy-2-naphthoic acid
• 1,3-Dihydroxy-2-naphtoicacid
• 2-Naphthalenecarboxylic acid, 1,3-dihydroxy-

1,3-Dihydroxy-2-naphthoic acid

CAS: 3147-58-8

1,3-Dihydroxy-2-naphthoic acid

Formula: C₁₁H₈O₄

Purity: 98%

Molecular weight: 204.18

Ref: 54-OR1007447

1,3-Dihydroxy-2-naphthoic acid

CAS: 3147-58-8

Formula: C₁₁H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.1788

Ref: IN-DA00CHRJ

1,3-Dihydroxy-2-naphthoic acid

CAS: 3147-58-8

1,3-Dihydroxy-2-naphthoic acid

Formula: C₁₁H₈O₄

Purity: 98%

Molecular weight: 204.18

Ref: IN-DG227130

1,3-Dihydroxy-2-naphthoic acid

CAS: 3147-58-8

Formula: C₁₁H₈O₄

Purity: 98%

Molecular weight: 204.181

Ref: 10-F210554

1,3-Dihydroxy-2-naphthoic acid

CAS: 3147-58-8

1,3-Dihydroxy-2-naphthoic acid is an organic compound that belongs to the binaphthyls. It is a white solid that can be obtained by reacting naphthalene with inorganic phosphite in the presence of acidic potassium carbonate. This reaction system produces 1,3-dihydroxy-2-naphthoic acid and potassium biphosphite as byproducts. The reaction time depends on the concentration of reactants. 1,3-Dihydroxy-2-naphthoic acid has acidic properties and can be used as a catalyst for chemical reactions involving carboxylic compounds. This compound has been shown to be effective at treating abdominal pain caused by intestinal inflammation or infection with a carbon source such as carbohydrates (e.g., glucose) or fats (e.g., oleic acid).

Formula: C₁₁H₈O₄

Purity: Min. 95%

Molecular weight: 204.18 g/mol

Ref: 3D-FD154238