CAS 3147-62-4

3,5-Dihydroxybenzamide

Description:

3,5-Dihydroxybenzamide, with the CAS number 3147-62-4, is an organic compound characterized by the presence of two hydroxyl (-OH) groups attached to a benzene ring, specifically at the 3 and 5 positions, along with an amide functional group (-C(=O)NH2). This compound typically appears as a solid and is soluble in polar solvents due to its ability to form hydrogen bonds. The hydroxyl groups contribute to its reactivity and potential as a ligand in coordination chemistry. 3,5-Dihydroxybenzamide may exhibit biological activity, making it of interest in pharmaceutical research, particularly for its potential antioxidant properties. Its structure allows for various chemical modifications, which can enhance its efficacy or alter its properties for specific applications. Additionally, the compound can participate in various chemical reactions, including acylation and esterification, due to the presence of the amide group. Overall, 3,5-Dihydroxybenzamide is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h1-3,9-10H,(H2,8,11)

InChI key: InChIKey=PLYYMFBDRBSPJZ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC(O)=CC(O)=C1

Synonyms:

• 3,5-Dihydroxy Benzomide
• 3,5-Dihydroxy-Benzamide
• 3,5-Dihydroxybenzoic acid amide
• Benzamide, 3,5-dihydroxy-
• NSC 60729
• α-Resorcylamide
• 3,5-Dihydroxybenzamide

3,5-Dihydroxybenzamide

CAS: 3147-62-4

Formula: C₇H₇NO₃

Purity: >98.0%(HPLC)(N)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 153.14

Ref: 3B-D2875

3,5-Dihydroxybenzamide

CAS: 3147-62-4

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA00BZCB

3,5-Dihydroxybenzamide

CAS: 3147-62-4

3,5-Dihydroxybenzamide

Purity: 98%

Molecular weight: 153.14g/mol

Ref: 54-OR1010809

3,5-Dihydroxybenzamide

CAS: 3147-62-4

3,5-Dihydroxybenzamide is an amide derivative that has anticancer activity. This compound inhibits the growth of C. glabrata by inhibiting protein synthesis in the mitochondria and DNA replication in the nucleus. 3,5-Dihydroxybenzamide also inhibits the growth of cancer cells by binding to a molecule that is involved in cancer cell proliferation. The inhibitor molecule binds to a specific site on the molecule, preventing it from forming new cancer cells. The mechanism of action for this compound is not known, but may be due to its ability to bind with chloride ions or its ability to form supramolecular chemistry with other molecules.

Formula: C₇H₇NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 153.14 g/mol

Ref: 3D-FD61768

3,5-Dihydroxybenzamide

CAS: 3147-62-4

Formula: C₇H₇NO₃

Purity: 98%+(HPLC);RG

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F049596