CymitQuimica logo

CAS 314725-14-9

:

Benzo[b]thiophene-6-carboxylic acid, 4-hydroxy-, methyl ester

Description:
Benzo[b]thiophene-6-carboxylic acid, 4-hydroxy-, methyl ester is an organic compound characterized by its unique structure that includes a benzo[b]thiophene core, a carboxylic acid functional group, and a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the carboxylic acid and hydroxyl groups. The methyl ester form suggests that it can undergo hydrolysis to yield the corresponding acid, which may have implications for its solubility and reactivity in various solvents. The presence of the hydroxyl group can also enhance hydrogen bonding capabilities, influencing its physical properties such as boiling point and solubility in polar solvents. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Overall, the characteristics of this compound make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C10H8O3S
InChI:InChI=1S/C10H8O3S/c1-13-10(12)6-4-8(11)7-2-3-14-9(7)5-6/h2-5,11H,1H3
InChI key:IRAYMNSJGYCOHV-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C2C=CSC2=C1)O
Found 2 products.