CAS 314742-00-2

7-(2,4-Dinitrophenoxy)-4-methyl-2H-1-benzopyran-2-one

Description:

7-(2,4-Dinitrophenoxy)-4-methyl-2H-1-benzopyran-2-one, with the CAS number 314742-00-2, is a synthetic organic compound characterized by its complex structure, which includes a benzopyran moiety and a dinitrophenoxy group. This compound typically exhibits properties associated with flavonoids, such as antioxidant activity, and may have applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dinitrophenyl group suggests potential reactivity and biological activity, which could be leveraged in medicinal chemistry. Its molecular structure contributes to its solubility and stability in various solvents, influencing its behavior in chemical reactions and biological systems. Additionally, the compound may exhibit specific spectral characteristics, such as UV-Vis absorbance, due to the conjugated systems present in its structure. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of nitro groups, which can pose hazards. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic applications.

Formula: C₁₆H₁₀N₂O₇

InChI: InChI=1S/C16H10N2O7/c1-9-6-16(19)25-15-8-11(3-4-12(9)15)24-14-5-2-10(17(20)21)7-13(14)18(22)23/h2-8H,1H3

InChI key: InChIKey=CHCWRLPZTULFBO-UHFFFAOYSA-N

SMILES: CC=1C=2C(=CC(OC3=C(N(=O)=O)C=C(N(=O)=O)C=C3)=CC2)OC(=O)C1

Synonyms:

• 7-(2,4-Dinitrophenoxy)-4-methyl-2H-1-benzopyran-2-one
• 2H-1-Benzopyran-2-one, 7-(2,4-dinitrophenoxy)-4-methyl-

7-(2,4-Dinitrophenoxy)-4-methyl-2H-chromen-2-one

CAS: 314742-00-2

7-(2,4-Dinitrophenoxy)-4-methyl-2H-chromen-2-one (Compound 1) serves as a fluorescent probe for detecting hydrogen sulfide (H2S). It is characterized by a low detection limit (4×10^-6 mol/L), high selectivity, and great sensitivity. At a concentration of 150 µg/mL, it exhibits negligible cytotoxicity. The excitation wavelength is 331 nm, while in DMSO solvent, it emits at approximately 385 nm; upon addition of HS-, the fluorescence intensity significantly increases around 392 nm.

Formula: C₁₆H₁₀N₂O₇

Color and Shape: Solid

Molecular weight: 342.26

Ref: TM-T203325

7-(2,4-Dinitrophenoxy)-4-methyl-2H-chromen-2-one

CAS: 314742-00-2

Please enquire for more information about 7-(2,4-Dinitrophenoxy)-4-methyl-2H-chromen-2-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₁₀N₂O₇

Purity: Min. 95%

Molecular weight: 342.26 g/mol

Ref: 3D-PMA74200