CAS 314742-22-8

[(4-ethyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid

Description:

The chemical substance known as [(4-ethyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid, with the CAS number 314742-22-8, is a derivative of coumarin, a class of compounds known for their aromatic properties and biological activities. This compound features a coumarin backbone, characterized by a benzopyrone structure, which contributes to its potential pharmacological effects. The presence of the ethyl group and the carboxylic acid functionality enhances its solubility and reactivity. Typically, compounds like this exhibit properties such as antioxidant, anti-inflammatory, and antimicrobial activities, making them of interest in medicinal chemistry. The specific functional groups present in this molecule suggest it may participate in various chemical reactions, including esterification and amidation. Additionally, its structural characteristics may allow for interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, the stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₃H₁₂O₅

InChI: InChI=1/C13H12O5/c1-2-8-5-13(16)18-11-6-9(3-4-10(8)11)17-7-12(14)15/h3-6H,2,7H2,1H3,(H,14,15)

SMILES: CCc1cc(=O)oc2cc(ccc12)OCC(=O)O

[(4-ethyl-2-oxo-2H-chromen-7-yl)oxy]acetic acid

CAS: 314742-22-8

Formula: C₁₃H₁₂O₅

Purity: 95.0%

Molecular weight: 248.234

Ref: 10-F314852