CymitQuimica logo

CAS 314742-28-4

:

4-ethyl-7-(1-methyl-2-oxopropoxy)-2H-chromen-2-one

Description:
4-Ethyl-7-(1-methyl-2-oxopropoxy)-2H-chromen-2-one, with the CAS number 314742-28-4, is a synthetic organic compound belonging to the class of flavonoids, specifically a coumarin derivative. This compound features a chromenone structure, characterized by a fused benzene and α-pyrone ring system, which contributes to its potential biological activities. The presence of an ethyl group and a propoxy substituent enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. Coumarin derivatives are known for various pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. The specific functional groups in this compound may also suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's structural features may allow for further modifications, leading to a diverse range of derivatives with tailored biological activities. As with many organic compounds, the stability, reactivity, and biological effects of 4-ethyl-7-(1-methyl-2-oxopropoxy)-2H-chromen-2-one would depend on its specific chemical environment and conditions.
Formula:C15H16O4
InChI:InChI=1/C15H16O4/c1-4-11-7-15(17)19-14-8-12(5-6-13(11)14)18-10(3)9(2)16/h5-8,10H,4H2,1-3H3
InChI key:QRPCBZXHJWLZKD-UHFFFAOYSA-N
SMILES:CCc1cc(=O)oc2cc(ccc12)OC(C)C(=O)C
Found 3 products.