CAS 314744-87-1

4-methyl-3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one

Description:

4-Methyl-3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one, with the CAS number 314744-87-1, is a synthetic organic compound that belongs to the class of flavonoids, specifically a type of chromone. This compound features a complex structure characterized by a benzo[c]chromene core, which is fused with a chromone moiety. The presence of a methyl group and a propoxy group contributes to its unique chemical properties. It is typically characterized by its yellow to orange color, which is common among flavonoids, and may exhibit fluorescence under UV light. The compound may possess biological activities, including antioxidant and anti-inflammatory properties, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may be stable under standard laboratory conditions. However, like many organic compounds, it should be handled with care, considering potential reactivity and toxicity. Further studies are often required to fully elucidate its properties and potential applications in various fields, including medicine and materials science.

Formula: C₁₈H₁₆O₄

InChI: InChI=1/C18H16O4/c1-10-16(21-12(3)11(2)19)9-8-14-13-6-4-5-7-15(13)18(20)22-17(10)14/h4-9,12H,1-3H3

SMILES: Cc1c(ccc2c3ccccc3c(=O)oc12)OC(C)C(=O)C

Synonyms:

• 4-Methyl-3-[(3-oxobutan-2-yl)oxy]-6H-benzo[c]chromen-6-one

4-methyl-3-(1-methyl-2-oxopropoxy)-6H-benzo[c]chromen-6-one

CAS: 314744-87-1

Purity: 95.0%

Molecular weight: 296.3219909667969

Ref: 10-F314836