CAS 31478-45-2
:Bamnidazole
Description:
Bamnidazole, with the CAS number 31478-45-2, is a synthetic compound that belongs to the class of nitroimidazoles, which are known for their antimicrobial and antiparasitic properties. This substance is characterized by its ability to interact with DNA, leading to the disruption of nucleic acid synthesis in target organisms. Bamnidazole is primarily used in the treatment of various infections, particularly those caused by anaerobic bacteria and certain protozoa. Its mechanism of action involves the reduction of the nitro group, which generates reactive intermediates that can damage cellular components. The compound is typically administered in a pharmaceutical formulation, and its efficacy can be influenced by factors such as dosage, route of administration, and the specific pathogen involved. Additionally, like many nitroimidazoles, Bamnidazole may exhibit side effects, including gastrointestinal disturbances and potential interactions with alcohol. Overall, Bamnidazole represents a valuable tool in the arsenal against specific infectious diseases, contributing to the broader field of antimicrobial therapy.
Formula:C7H10N4O4
InChI:InChI=1S/C7H10N4O4/c1-5-9-4-6(11(13)14)10(5)2-3-15-7(8)12/h4H,2-3H2,1H3,(H2,8,12)
InChI key:InChIKey=JOVXEDBYAWFQQX-UHFFFAOYSA-N
SMILES:C(COC(N)=O)N1C(N(=O)=O)=CN=C1C
Synonyms:- 1H-Imidazole-1-ethanol, 2-methyl-5-nitro-, 1-carbamate
- 1H-imidazole-1-ethanol, 2-methyl-5-nitro-, carbamate (ester)
- 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl carbamate
- 2-(2-Methyl-5-nitroimidazol-1-yl)ethyl carbamate
- 250-650-6
- Imidazole-1-ethanol, 2-methyl-5-nitro-, carbamate (ester)
- NSC 329676
- Rp 20578
- Bamnidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl carbamate
CAS:2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl carbamate is a diluent that can be used to reconstitute fatty acids at high concentrations. It is also used in pharmaceutical preparations and conjugates. It has been shown to have an antiviral effect against chlamydia and has been used as a pharmaceutical dosage for the diagnosis of radiation exposure. The diluent can also be used in pharmaceutical preparations and conjugates, but it is not active against viruses or bacteria.Formula:C7H10N4O4Purity:Min. 95%Molecular weight:214.18 g/mol

