CAS 3148-42-3
:methyl (19beta)-10,11-dimethoxy-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate
Description:
Methyl (19beta)-10,11-dimethoxy-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate, with CAS number 3148-42-3, is a chemical compound that belongs to the class of alkaloids, specifically derived from the yohimbe tree. This compound is characterized by its complex structure, which includes multiple methoxy groups and a carboxylate functional group, contributing to its potential biological activity. It exhibits properties typical of yohimbine derivatives, which may include effects on the central nervous system and potential applications in pharmacology, particularly in the context of sexual health and as an aphrodisiac. The presence of the oxayohimban framework suggests that it may interact with various receptors in the body, although specific mechanisms of action would require further investigation. Additionally, its solubility and stability can be influenced by the methoxy substituents, which may affect its bioavailability and therapeutic efficacy. Overall, this compound represents a unique structure within the realm of natural product chemistry, with potential implications for medicinal chemistry and drug development.
Formula:C23H28N2O5
InChI:InChI=1/C23H28N2O5/c1-12-16-10-25-6-5-13-15-8-20(27-2)21(28-3)9-18(15)24-22(13)19(25)7-14(16)17(11-30-12)23(26)29-4/h8-9,11-12,14,16,19,24H,5-7,10H2,1-4H3/t12-,14+,16-,19+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
