CAS 31486-86-9

thieno[3,2-b]thiophene-2-carbaldehyde

Description:

Thieno[3,2-b]thiophene-2-carbaldehyde is an organic compound characterized by its unique fused thiophene rings, which contribute to its aromatic properties and electronic characteristics. This compound features a carbaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of sulfur atoms in the thiophene rings enhances its electron-rich nature, making it suitable for use in organic electronics, such as organic semiconductors and photovoltaic materials. Thieno[3,2-b]thiophene derivatives are often explored for their role in enhancing charge transport properties in various applications. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structural features allow for potential modifications, making it a versatile building block in the synthesis of more complex organic molecules. Overall, thieno[3,2-b]thiophene-2-carbaldehyde is significant in materials science and organic chemistry due to its distinctive properties and functional versatility.

Formula: C₇H₄OS₂

InChI: InChI=1/C7H4OS2/c8-4-5-3-7-6(10-5)1-2-9-7/h1-4H

SMILES: c1csc2cc(C=O)sc12

Synonyms:

• Thieno[3,2-B]Thiophene-2-Carboxaldehyde

THIENO[3,2-B]THIOPHENE-2-CARBALDEHYDE

CAS: 31486-86-9

Formula: C₇H₄OS₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.2361

Ref: IN-DA003US2

Thieno[3,2-b]thiophene-2-carboxaldehyde

CAS: 31486-86-9

Thieno[3,2-b]thiophene-2-carboxaldehyde

Formula: C₇H₄OS₂

Purity: 97%

Color and Shape: orange solid

Molecular weight: 168.24g/mol

Ref: 54-OR101767

Thieno[3,2,-b]thiophene-2-carbaldehyde

CAS: 31486-86-9

Thieno[3,2,-b]thiophene-2-carbaldehyde is a molecule that can be used in supramolecular chemistry. It has processability and pharmacokinetic properties as well as a good morphology. This molecule has been shown to be an excellent chemosensor. Thieno[3,2,-b]thiophene-2-carbaldehyde has also been shown to enhance the optical properties of semiconducting nanocrystals. The supramolecular chemistry of this molecule will allow for it to be analyzed with simulations and the optical properties will provide for its enhancement.

Formula: C₇H₄OS₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 168.24 g/mol

Ref: 3D-FT33133

Thieno[3,2-b]thiophene-2-carbaldehyde

CAS: 31486-86-9

Formula: C₇H₄OS₂

Purity: 95%

Molecular weight: 168.23

Ref: 10-F241895