CAS 31518-14-6
:3,4-dihydro-2H-pyran-6-carboxylic acid
Description:
3,4-Dihydro-2H-pyran-6-carboxylic acid is a heterocyclic organic compound characterized by a pyran ring structure with a carboxylic acid functional group. This compound features a six-membered ring containing one oxygen atom and is saturated, which contributes to its stability and reactivity. The presence of the carboxylic acid group makes it a polar molecule, enhancing its solubility in polar solvents such as water. This compound is of interest in organic synthesis and medicinal chemistry due to its potential applications in the development of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electrophilic nature of the carboxylic acid, allowing for various chemical transformations, including esterification and amidation. Additionally, the dihydropyran structure can participate in cycloaddition reactions and serve as a building block for more complex molecules. Overall, 3,4-dihydro-2H-pyran-6-carboxylic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C6H8O3
InChI:InChI=1/C6H8O3/c7-6(8)5-3-1-2-4-9-5/h3H,1-2,4H2,(H,7,8)
SMILES:C1CCOC(=C1)C(=O)O
Synonyms:- 2H-Pyran-6-carboxylic acid, 3,4-dihydro-
- 31518-14-6
- 5,6-Dihydro-4H-pyran-2-carboxylic Acid
- 3,4-Dihydro-2H-pyran-6-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dihydro-2H-pyran-6-carboxylic acid
CAS:Formula:C6H8O3Purity:98%Color and Shape:SolidMolecular weight:128.12595,6-Dihydro-4h-pyran-2-carboxylic acid
CAS:5,6-Dihydro-4h-pyran-2-carboxylic acidFormula:C6H8O3Purity:97%Color and Shape: light yellow solidMolecular weight:128.13g/mol3,4-Dihydro-2H-pyran-6-carboxylic acid
CAS:Formula:C6H8O3Purity:95%Color and Shape:SolidMolecular weight:128.1275,6-Dihydro-4h-pyran-2-carboxylic acid
CAS:5,6-Dihydro-4H-pyran-2-carboxylic acid is a diluent that is used in the manufacture of dry powders. It is also used as a diluting agent for influenza vaccines. 5,6-Dihydro-4H-pyran-2-carboxylic acid is one of the most commonly used diluents for vaccines and other biological products. This compound has been approved by the FDA for use in both injectable and nasal flu vaccine preparations. The particle size of this compound ranges from microns to millimeters. 5,6-Dihydro-4H-pyran-2-carboxylic acid can be mixed with water or saline to produce a solution with a pH between 3 and 8.Formula:C6H8O3Purity:Min. 95%Molecular weight:128.13 g/mol



