CAS 3152-43-0
:3,4-Di-O-acetyl-D-xylal
Description:
3,4-Di-O-acetyl-D-xylal is a chemical compound that belongs to the class of carbohydrates, specifically a derivative of D-xylal, which is a sugar alcohol. This compound is characterized by the presence of two acetyl groups attached to the hydroxyl groups at the 3 and 4 positions of the D-xylal molecule. The acetylation enhances the compound's stability and solubility in organic solvents, making it useful in various chemical applications. It typically appears as a white to off-white crystalline solid and is soluble in polar organic solvents. The compound is of interest in organic synthesis and carbohydrate chemistry, often serving as an intermediate in the preparation of more complex molecules. Its reactivity is influenced by the acetyl groups, which can undergo hydrolysis or participate in further chemical reactions. As with many acetylated sugars, it may exhibit specific biological activities, although detailed studies on its biological properties may be limited. Proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C9H12O5
InChI:InChI=1/C9H12O5/c1-6(10)13-8-3-4-12-5-9(8)14-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9-/m1/s1
SMILES:CC(=O)O[C@@H]1C=COC[C@H]1OC(=O)C
Synonyms:- 2,3-di-O-acetyl-1,5-anhydro-4-deoxy-D-threo-pent-4-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4-Di-O-acetyl-D-xylal
CAS:Formula:C9H12O5Purity:≥ 98.0%Color and Shape:Yellow oily liquidMolecular weight:200.193,4-Di-O-acetyl-D-xylal
CAS:3,4-Di-O-acetyl-D-xylal is a sterically hindered substrate analogue of the natural L-xylal. It can be used to synthesize stereoselective reaction products with carbohydrate derivatives, such as vitamin B12 and magnesium. 3,4-Di-O-acetyl-D-xylal has been shown to react with azides and hydroxymethyl groups to produce formyl and formate groups. The nmr spectra of this compound show strong signals for the acetoxy group at 2.2 ppm and the hydroxymethyl group at 2.6 ppm. Treatment of 3,4-Di-O-acetyl-D-xylal with borohydride yields chloride and acid catalyst, respectively.
Formula:C9H12O5Purity:Min. 98%Color and Shape:Colorless Yellow Clear LiquidMolecular weight:200.19 g/mol


