CAS 31525-22-1

3-(2,2-dimethylhydrazino)-4-ethoxycyclobut-3-ene-1,2-dione

Description:

3-(2,2-Dimethylhydrazino)-4-ethoxycyclobut-3-ene-1,2-dione, identified by its CAS number 31525-22-1, is a chemical compound characterized by its unique structural features, including a cyclobutene ring and a dione functional group. The presence of the dimethylhydrazino group suggests potential reactivity and biological activity, as hydrazines are known for their use in various chemical syntheses and as intermediates in pharmaceuticals. The ethoxy group contributes to the compound's solubility and may influence its reactivity and interaction with other molecules. This compound may exhibit properties such as moderate stability under standard conditions, but its reactivity can be influenced by the presence of the hydrazine moiety, which can participate in various chemical reactions, including oxidation and condensation. Additionally, the compound's potential applications could span across medicinal chemistry and materials science, although specific applications would depend on further research into its biological activity and chemical behavior. Overall, this compound represents a fascinating area of study within organic chemistry.

Formula: C₈H₁₂N₂O₃

InChI: InChI=1/C8H12N2O3/c1-4-13-8-5(9-10(2)3)6(11)7(8)12/h9H,4H2,1-3H3

SMILES: CCOC1=C(C(=O)C1=O)NN(C)C

3-(2,2-dimethylhydrazino)-4-ethoxycyclobut-3-ene-1,2-dione

CAS: 31525-22-1

3-(2,2-dimethylhydrazino)-4-ethoxycyclobut-3-ene-1,2-dione

Purity: ≥95%

Molecular weight: 184.19g/mol

Ref: 54-OR26834